C12H15N7S — CID 114785147
2-N-ethyl-6-N-[2-(1,3-thiazol-2-yl)ethyl]-7H-purine-2,6-diamine (PubChem CID 114785147) has the molecular formula C12H15N7S and a molecular weight of 289.37 g/mol. Its IUPAC name is 2-N-ethyl-6-N-[2-(1,3-thiazol-2-yl)ethyl]-7H-purine-2,6-diamine.
| Compound Name | 2-N-ethyl-6-N-[2-(1,3-thiazol-2-yl)ethyl]-7H-purine-2,6-diamine |
|---|---|
| PubChem CID | 114785147 |
| Molecular Formula | C12H15N7S |
| Molecular Weight | 289.37 g/mol |
| Exact Mass | 289.11 |
| IUPAC Name | 2-N-ethyl-6-N-[2-(1,3-thiazol-2-yl)ethyl]-7H-purine-2,6-diamine |
| SMILES | CCNc1nc(NCCc2nccs2)c2[nH]cnc2n1 |
| InChI | InChI=1S/C12H15N7S/c1-2-13-12-18-10(9-11(19-12)17-7-16-9)15-4-3-8-14-5-6-20-8/h5-7H,2-4H2,1H3,(H3,13,15,16,17,18,19) |
| InChIKey | WDNVEEWVQOWXBP-UHFFFAOYSA-N |
| XLogP | 1.90 |
| TPSA | 91.41 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.37 |
| LogP ≤ 5 | 1.90 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |