C20H17N5O2 — CID 23761575
3-(1H-imidazol-5-yl)-2-[(2-phenylquinazolin-4-yl)amino]propanoic acid (PubChem CID 23761575) has the molecular formula C20H17N5O2 and a molecular weight of 359.39 g/mol. Its IUPAC name is 3-(1H-imidazol-5-yl)-2-[(2-phenylquinazolin-4-yl)amino]propanoic acid.
| Compound Name | 3-(1H-imidazol-5-yl)-2-[(2-phenylquinazolin-4-yl)amino]propanoic acid |
|---|---|
| PubChem CID | 23761575 |
| Molecular Formula | C20H17N5O2 |
| Molecular Weight | 359.39 g/mol |
| Exact Mass | 359.14 |
| IUPAC Name | 3-(1H-imidazol-5-yl)-2-[(2-phenylquinazolin-4-yl)amino]propanoic acid |
| SMILES | O=C(O)C(Cc1cnc[nH]1)Nc1nc(-c2ccccc2)nc2ccccc12 |
| InChI | InChI=1S/C20H17N5O2/c26-20(27)17(10-14-11-21-12-22-14)24-19-15-8-4-5-9-16(15)23-18(25-19)13-6-2-1-3-7-13/h1-9,11-12,17H,10H2,(H,21,22)(H,26,27)(H,23,24,25) |
| InChIKey | LSGKEGOYUVTQOP-UHFFFAOYSA-N |
| XLogP | 3.13 |
| TPSA | 103.79 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.39 |
| LogP ≤ 5 | 3.13 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |