C14H15F2N3O2 — CID 122049640
(2S)-2-[[2-(difluoromethyl)quinazolin-4-yl]amino]-3-methylbutanoic acid (PubChem CID 122049640) has the molecular formula C14H15F2N3O2 and a molecular weight of 295.29 g/mol. Its IUPAC name is (2S)-2-[[2-(difluoromethyl)quinazolin-4-yl]amino]-3-methylbutanoic acid.
| Compound Name | (2S)-2-[[2-(difluoromethyl)quinazolin-4-yl]amino]-3-methylbutanoic acid |
|---|---|
| PubChem CID | 122049640 |
| Molecular Formula | C14H15F2N3O2 |
| Molecular Weight | 295.29 g/mol |
| Exact Mass | 295.11 |
| IUPAC Name | (2S)-2-[[2-(difluoromethyl)quinazolin-4-yl]amino]-3-methylbutanoic acid |
| SMILES | CC(C)[C@H](Nc1nc(C(F)F)nc2ccccc12)C(=O)O |
| InChI | InChI=1S/C14H15F2N3O2/c1-7(2)10(14(20)21)18-12-8-5-3-4-6-9(8)17-13(19-12)11(15)16/h3-7,10-11H,1-2H3,(H,20,21)(H,17,18,19)/t10-/m0/s1 |
| InChIKey | MXNQYQWFOHPXCS-JTQLQIEISA-N |
| XLogP | 3.09 |
| TPSA | 75.11 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.29 |
| LogP ≤ 5 | 3.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |