C20H21F2N3O — CID 56575108
2-(difluoromethyl)-N-[1-(4-methoxyphenyl)-2-methylpropyl]quinazolin-4-amine (PubChem CID 56575108) has the molecular formula C20H21F2N3O and a molecular weight of 357.40 g/mol. Its IUPAC name is 2-(difluoromethyl)-N-[1-(4-methoxyphenyl)-2-methylpropyl]quinazolin-4-amine.
| Compound Name | 2-(difluoromethyl)-N-[1-(4-methoxyphenyl)-2-methylpropyl]quinazolin-4-amine |
|---|---|
| PubChem CID | 56575108 |
| Molecular Formula | C20H21F2N3O |
| Molecular Weight | 357.40 g/mol |
| Exact Mass | 357.17 |
| IUPAC Name | 2-(difluoromethyl)-N-[1-(4-methoxyphenyl)-2-methylpropyl]quinazolin-4-amine |
| SMILES | COc1ccc(C(Nc2nc(C(F)F)nc3ccccc23)C(C)C)cc1 |
| InChI | InChI=1S/C20H21F2N3O/c1-12(2)17(13-8-10-14(26-3)11-9-13)24-19-15-6-4-5-7-16(15)23-20(25-19)18(21)22/h4-12,17-18H,1-3H3,(H,23,24,25) |
| InChIKey | OYSARLYGNKGULC-UHFFFAOYSA-N |
| XLogP | 5.39 |
| TPSA | 47.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.40 |
| LogP ≤ 5 | 5.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |