C22H18F2N4 — CID 133414736
2-(difluoromethyl)-N-[(3-methylphenyl)-pyridin-2-ylmethyl]quinazolin-4-amine (PubChem CID 133414736) has the molecular formula C22H18F2N4 and a molecular weight of 376.41 g/mol. Its IUPAC name is 2-(difluoromethyl)-N-[(3-methylphenyl)-pyridin-2-ylmethyl]quinazolin-4-amine.
| Compound Name | 2-(difluoromethyl)-N-[(3-methylphenyl)-pyridin-2-ylmethyl]quinazolin-4-amine |
|---|---|
| PubChem CID | 133414736 |
| Molecular Formula | C22H18F2N4 |
| Molecular Weight | 376.41 g/mol |
| Exact Mass | 376.15 |
| IUPAC Name | 2-(difluoromethyl)-N-[(3-methylphenyl)-pyridin-2-ylmethyl]quinazolin-4-amine |
| SMILES | Cc1cccc(C(Nc2nc(C(F)F)nc3ccccc23)c2ccccn2)c1 |
| InChI | InChI=1S/C22H18F2N4/c1-14-7-6-8-15(13-14)19(18-11-4-5-12-25-18)27-21-16-9-2-3-10-17(16)26-22(28-21)20(23)24/h2-13,19-20H,1H3,(H,26,27,28) |
| InChIKey | AENLDCAPSWSUTQ-UHFFFAOYSA-N |
| XLogP | 5.47 |
| TPSA | 50.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.41 |
| LogP ≤ 5 | 5.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |