C19H16F3N3 — CID 133414669
N-[(3-methylphenyl)-pyridin-2-ylmethyl]-4-(trifluoromethyl)pyridin-2-amine (PubChem CID 133414669) has the molecular formula C19H16F3N3 and a molecular weight of 343.35 g/mol. Its IUPAC name is N-[(3-methylphenyl)-pyridin-2-ylmethyl]-4-(trifluoromethyl)pyridin-2-amine.
| Compound Name | N-[(3-methylphenyl)-pyridin-2-ylmethyl]-4-(trifluoromethyl)pyridin-2-amine |
|---|---|
| PubChem CID | 133414669 |
| Molecular Formula | C19H16F3N3 |
| Molecular Weight | 343.35 g/mol |
| Exact Mass | 343.13 |
| IUPAC Name | N-[(3-methylphenyl)-pyridin-2-ylmethyl]-4-(trifluoromethyl)pyridin-2-amine |
| SMILES | Cc1cccc(C(Nc2cc(C(F)(F)F)ccn2)c2ccccn2)c1 |
| InChI | InChI=1S/C19H16F3N3/c1-13-5-4-6-14(11-13)18(16-7-2-3-9-23-16)25-17-12-15(8-10-24-17)19(20,21)22/h2-12,18H,1H3,(H,24,25) |
| InChIKey | OXHDPXMEXHGTIL-UHFFFAOYSA-N |
| XLogP | 5.01 |
| TPSA | 37.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.35 |
| LogP ≤ 5 | 5.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |