C20H16ClN3 — CID 133414861
4-chloro-2-[[(3-methylphenyl)-pyridin-2-ylmethyl]amino]benzonitrile (PubChem CID 133414861) has the molecular formula C20H16ClN3 and a molecular weight of 333.82 g/mol. Its IUPAC name is 4-chloro-2-[[(3-methylphenyl)-pyridin-2-ylmethyl]amino]benzonitrile.
| Compound Name | 4-chloro-2-[[(3-methylphenyl)-pyridin-2-ylmethyl]amino]benzonitrile |
|---|---|
| PubChem CID | 133414861 |
| Molecular Formula | C20H16ClN3 |
| Molecular Weight | 333.82 g/mol |
| Exact Mass | 333.10 |
| IUPAC Name | 4-chloro-2-[[(3-methylphenyl)-pyridin-2-ylmethyl]amino]benzonitrile |
| SMILES | Cc1cccc(C(Nc2cc(Cl)ccc2C#N)c2ccccn2)c1 |
| InChI | InChI=1S/C20H16ClN3/c1-14-5-4-6-15(11-14)20(18-7-2-3-10-23-18)24-19-12-17(21)9-8-16(19)13-22/h2-12,20,24H,1H3 |
| InChIKey | HCQWOJGYMUOUEG-UHFFFAOYSA-N |
| XLogP | 5.12 |
| TPSA | 48.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.82 |
| LogP ≤ 5 | 5.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |