C17H14Cl2N4O — CID 133364168
4-chloro-5-[[(3-chlorophenyl)-pyridin-2-ylmethyl]amino]-2-methylpyridazin-3-one (PubChem CID 133364168) has the molecular formula C17H14Cl2N4O and a molecular weight of 361.23 g/mol. Its IUPAC name is 4-chloro-5-[[(3-chlorophenyl)-pyridin-2-ylmethyl]amino]-2-methylpyridazin-3-one.
| Compound Name | 4-chloro-5-[[(3-chlorophenyl)-pyridin-2-ylmethyl]amino]-2-methylpyridazin-3-one |
|---|---|
| PubChem CID | 133364168 |
| Molecular Formula | C17H14Cl2N4O |
| Molecular Weight | 361.23 g/mol |
| Exact Mass | 360.05 |
| IUPAC Name | 4-chloro-5-[[(3-chlorophenyl)-pyridin-2-ylmethyl]amino]-2-methylpyridazin-3-one |
| SMILES | Cn1ncc(NC(c2cccc(Cl)c2)c2ccccn2)c(Cl)c1=O |
| InChI | InChI=1S/C17H14Cl2N4O/c1-23-17(24)15(19)14(10-21-23)22-16(13-7-2-3-8-20-13)11-5-4-6-12(18)9-11/h2-10,16,22H,1H3 |
| InChIKey | JZXOQEDUPCICQN-UHFFFAOYSA-N |
| XLogP | 3.68 |
| TPSA | 59.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.23 |
| LogP ≤ 5 | 3.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |