C21H21ClN4O2S — CID 133364190
N-[(3-chlorophenyl)-pyridin-2-ylmethyl]-5-pyrrolidin-1-ylsulfonylpyridin-2-amine (PubChem CID 133364190) has the molecular formula C21H21ClN4O2S and a molecular weight of 428.95 g/mol. Its IUPAC name is N-[(3-chlorophenyl)-pyridin-2-ylmethyl]-5-pyrrolidin-1-ylsulfonylpyridin-2-amine.
| Compound Name | N-[(3-chlorophenyl)-pyridin-2-ylmethyl]-5-pyrrolidin-1-ylsulfonylpyridin-2-amine |
|---|---|
| PubChem CID | 133364190 |
| Molecular Formula | C21H21ClN4O2S |
| Molecular Weight | 428.95 g/mol |
| Exact Mass | 428.11 |
| IUPAC Name | N-[(3-chlorophenyl)-pyridin-2-ylmethyl]-5-pyrrolidin-1-ylsulfonylpyridin-2-amine |
| SMILES | O=S(=O)(c1ccc(NC(c2cccc(Cl)c2)c2ccccn2)nc1)N1CCCC1 |
| InChI | InChI=1S/C21H21ClN4O2S/c22-17-7-5-6-16(14-17)21(19-8-1-2-11-23-19)25-20-10-9-18(15-24-20)29(27,28)26-12-3-4-13-26/h1-2,5-11,14-15,21H,3-4,12-13H2,(H,24,25) |
| InChIKey | DUESTSUUFYCLBF-UHFFFAOYSA-N |
| XLogP | 4.12 |
| TPSA | 75.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.95 |
| LogP ≤ 5 | 4.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |