C17H14ClN5O — CID 133364201
6-[[(3-chlorophenyl)-pyridin-2-ylmethyl]amino]pyridazine-3-carboxamide (PubChem CID 133364201) has the molecular formula C17H14ClN5O and a molecular weight of 339.79 g/mol. Its IUPAC name is 6-[[(3-chlorophenyl)-pyridin-2-ylmethyl]amino]pyridazine-3-carboxamide.
| Compound Name | 6-[[(3-chlorophenyl)-pyridin-2-ylmethyl]amino]pyridazine-3-carboxamide |
|---|---|
| PubChem CID | 133364201 |
| Molecular Formula | C17H14ClN5O |
| Molecular Weight | 339.79 g/mol |
| Exact Mass | 339.09 |
| IUPAC Name | 6-[[(3-chlorophenyl)-pyridin-2-ylmethyl]amino]pyridazine-3-carboxamide |
| SMILES | NC(=O)c1ccc(NC(c2cccc(Cl)c2)c2ccccn2)nn1 |
| InChI | InChI=1S/C17H14ClN5O/c18-12-5-3-4-11(10-12)16(13-6-1-2-9-20-13)21-15-8-7-14(17(19)24)22-23-15/h1-10,16H,(H2,19,24)(H,21,23) |
| InChIKey | SHNYFJCNICLBGY-UHFFFAOYSA-N |
| XLogP | 2.83 |
| TPSA | 93.79 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.79 |
| LogP ≤ 5 | 2.83 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |