C18H13ClF3N3 — CID 25357011
3-chloro-N-[(R)-phenyl(pyridin-2-yl)methyl]-5-(trifluoromethyl)pyridin-2-amine (PubChem CID 25357011) has the molecular formula C18H13ClF3N3 and a molecular weight of 363.77 g/mol. Its IUPAC name is 3-chloro-N-[(R)-phenyl(pyridin-2-yl)methyl]-5-(trifluoromethyl)pyridin-2-amine.
| Compound Name | 3-chloro-N-[(R)-phenyl(pyridin-2-yl)methyl]-5-(trifluoromethyl)pyridin-2-amine |
|---|---|
| PubChem CID | 25357011 |
| Molecular Formula | C18H13ClF3N3 |
| Molecular Weight | 363.77 g/mol |
| Exact Mass | 363.08 |
| IUPAC Name | 3-chloro-N-[(R)-phenyl(pyridin-2-yl)methyl]-5-(trifluoromethyl)pyridin-2-amine |
| SMILES | FC(F)(F)c1cnc(N[C@H](c2ccccc2)c2ccccn2)c(Cl)c1 |
| InChI | InChI=1S/C18H13ClF3N3/c19-14-10-13(18(20,21)22)11-24-17(14)25-16(12-6-2-1-3-7-12)15-8-4-5-9-23-15/h1-11,16H,(H,24,25)/t16-/m1/s1 |
| InChIKey | IDWRKHVTPSIWCO-MRXNPFEDSA-N |
| XLogP | 5.35 |
| TPSA | 37.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.77 |
| LogP ≤ 5 | 5.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |