C14H13F2N3 — CID 133362263
N-cyclopent-3-en-1-yl-2-(difluoromethyl)quinazolin-4-amine (PubChem CID 133362263) has the molecular formula C14H13F2N3 and a molecular weight of 261.28 g/mol. Its IUPAC name is N-cyclopent-3-en-1-yl-2-(difluoromethyl)quinazolin-4-amine.
| Compound Name | N-cyclopent-3-en-1-yl-2-(difluoromethyl)quinazolin-4-amine |
|---|---|
| PubChem CID | 133362263 |
| Molecular Formula | C14H13F2N3 |
| Molecular Weight | 261.28 g/mol |
| Exact Mass | 261.11 |
| IUPAC Name | N-cyclopent-3-en-1-yl-2-(difluoromethyl)quinazolin-4-amine |
| SMILES | FC(F)c1nc(NC2CC=CC2)c2ccccc2n1 |
| InChI | InChI=1S/C14H13F2N3/c15-12(16)14-18-11-8-4-3-7-10(11)13(19-14)17-9-5-1-2-6-9/h1-4,7-9,12H,5-6H2,(H,17,18,19) |
| InChIKey | TYAJXVOADUKHRO-UHFFFAOYSA-N |
| XLogP | 3.70 |
| TPSA | 37.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 261.28 |
| LogP ≤ 5 | 3.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|