About 2-(difluoromethyl)-N-(1,1-dioxo-7-oxa-1λ6-thiaspiro[3.5]nonan-3-yl)quinazolin-4-amine
2-(difluoromethyl)-N-(1,1-dioxo-7-oxa-1λ6-thiaspiro[3.5]nonan-3-yl)quinazolin-4-amine (PubChem CID 167978535) has the molecular formula C16H17F2N3O3S
and a molecular weight of 369.39 g/mol. Its IUPAC name is 2-(difluoromethyl)-N-(1,1-dioxo-7-oxa-1λ6-thiaspiro[3.5]nonan-3-yl)quinazolin-4-amine.
Molecular Properties
| Compound Name | 2-(difluoromethyl)-N-(1,1-dioxo-7-oxa-1λ6-thiaspiro[3.5]nonan-3-yl)quinazolin-4-amine |
| PubChem CID | 167978535 |
| Molecular Formula | C16H17F2N3O3S |
| Molecular Weight | 369.39 g/mol |
| Exact Mass | 369.10 |
| IUPAC Name | 2-(difluoromethyl)-N-(1,1-dioxo-7-oxa-1λ6-thiaspiro[3.5]nonan-3-yl)quinazolin-4-amine |
| SMILES | O=S1(=O)CC(Nc2nc(C(F)F)nc3ccccc23)C12CCOCC2 |
| InChI | InChI=1S/C16H17F2N3O3S/c17-13(18)15-19-11-4-2-1-3-10(11)14(21-15)20-12-9-25(22,23)16(12)5-7-24-8-6-16/h1-4,12-13H,5-9H2,(H,19,20,21) |
| InChIKey | LXZJPMDAWUDZDH-UHFFFAOYSA-N |
| XLogP | 2.33 |
| TPSA | 81.18 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 369.39 |
| LogP ≤ 5 | 2.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze 2-(difluoromethyl)-N-(1,1-dioxo-7-oxa-1λ6-thiaspiro[3.5]nonan-3-yl)quinazolin-4-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(difluoromethyl)-N-(1,1-dioxo-7-oxa-1λ6-thiaspiro[3.5]nonan-3-yl)quinazolin-4-amine?
The IUPAC name of 2-(difluoromethyl)-N-(1,1-dioxo-7-oxa-1λ6-thiaspiro[3.5]nonan-3-yl)quinazolin-4-amine (CID 167978535) is 2-(difluoromethyl)-N-(1,1-dioxo-7-oxa-1λ6-thiaspiro[3.5]nonan-3-yl)quinazolin-4-amine.
What is the SMILES notation for 2-(difluoromethyl)-N-(1,1-dioxo-7-oxa-1λ6-thiaspiro[3.5]nonan-3-yl)quinazolin-4-amine?
The canonical SMILES for 2-(difluoromethyl)-N-(1,1-dioxo-7-oxa-1λ6-thiaspiro[3.5]nonan-3-yl)quinazolin-4-amine is O=S1(=O)CC(Nc2nc(C(F)F)nc3ccccc23)C12CCOCC2.
What is the InChIKey of 2-(difluoromethyl)-N-(1,1-dioxo-7-oxa-1λ6-thiaspiro[3.5]nonan-3-yl)quinazolin-4-amine?
The InChIKey is LXZJPMDAWUDZDH-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H17F2N3O3S/c17-13(18)15-19-11-4-2-1-3-10(11)14(21-15)20-12-9-25(22,23)16(12)5-7-24-8-6-16/h1-4,12-13H,5-9H2,(H,19,20,21).
What are the key properties of 2-(difluoromethyl)-N-(1,1-dioxo-7-oxa-1λ6-thiaspiro[3.5]nonan-3-yl)quinazolin-4-amine?
2-(difluoromethyl)-N-(1,1-dioxo-7-oxa-1λ6-thiaspiro[3.5]nonan-3-yl)quinazolin-4-amine has a molecular weight of 369.39 g/mol, XLogP of 2.33, 3 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(difluoromethyl)-N-(1,1-dioxo-7-oxa-1λ6-thiaspiro[3.5]nonan-3-yl)quinazolin-4-amine is sourced from PubChem (CID 167978535), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).