C16H19F2N3O — CID 133496325
2-[2-[[2-(difluoromethyl)quinazolin-4-yl]amino]cyclopentyl]ethanol (PubChem CID 133496325) has the molecular formula C16H19F2N3O and a molecular weight of 307.34 g/mol. Its IUPAC name is 2-[2-[[2-(difluoromethyl)quinazolin-4-yl]amino]cyclopentyl]ethanol.
| Compound Name | 2-[2-[[2-(difluoromethyl)quinazolin-4-yl]amino]cyclopentyl]ethanol |
|---|---|
| PubChem CID | 133496325 |
| Molecular Formula | C16H19F2N3O |
| Molecular Weight | 307.34 g/mol |
| Exact Mass | 307.15 |
| IUPAC Name | 2-[2-[[2-(difluoromethyl)quinazolin-4-yl]amino]cyclopentyl]ethanol |
| SMILES | OCCC1CCCC1Nc1nc(C(F)F)nc2ccccc12 |
| InChI | InChI=1S/C16H19F2N3O/c17-14(18)16-20-13-6-2-1-5-11(13)15(21-16)19-12-7-3-4-10(12)8-9-22/h1-2,5-6,10,12,14,22H,3-4,7-9H2,(H,19,20,21) |
| InChIKey | WFSPTMCZXYLXGG-UHFFFAOYSA-N |
| XLogP | 3.53 |
| TPSA | 58.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.34 |
| LogP ≤ 5 | 3.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |