C14H18N4O — CID 106368086
[2-[(2-aminoquinazolin-4-yl)amino]cyclopentyl]methanol (PubChem CID 106368086) has the molecular formula C14H18N4O and a molecular weight of 258.32 g/mol. Its IUPAC name is [2-[(2-aminoquinazolin-4-yl)amino]cyclopentyl]methanol.
| Compound Name | [2-[(2-aminoquinazolin-4-yl)amino]cyclopentyl]methanol |
|---|---|
| PubChem CID | 106368086 |
| Molecular Formula | C14H18N4O |
| Molecular Weight | 258.32 g/mol |
| Exact Mass | 258.15 |
| IUPAC Name | [2-[(2-aminoquinazolin-4-yl)amino]cyclopentyl]methanol |
| SMILES | Nc1nc(NC2CCCC2CO)c2ccccc2n1 |
| InChI | InChI=1S/C14H18N4O/c15-14-17-12-6-2-1-5-10(12)13(18-14)16-11-7-3-4-9(11)8-19/h1-2,5-6,9,11,19H,3-4,7-8H2,(H3,15,16,17,18) |
| InChIKey | ZYWBRUZGAJNKTA-UHFFFAOYSA-N |
| XLogP | 1.78 |
| TPSA | 84.06 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 258.32 |
| LogP ≤ 5 | 1.78 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |