C14H15F2N3O2 — CID 133398979
[3-[[[2-(difluoromethyl)quinazolin-4-yl]amino]methyl]oxetan-3-yl]methanol (PubChem CID 133398979) has the molecular formula C14H15F2N3O2 and a molecular weight of 295.29 g/mol. Its IUPAC name is [3-[[[2-(difluoromethyl)quinazolin-4-yl]amino]methyl]oxetan-3-yl]methanol.
| Compound Name | [3-[[[2-(difluoromethyl)quinazolin-4-yl]amino]methyl]oxetan-3-yl]methanol |
|---|---|
| PubChem CID | 133398979 |
| Molecular Formula | C14H15F2N3O2 |
| Molecular Weight | 295.29 g/mol |
| Exact Mass | 295.11 |
| IUPAC Name | [3-[[[2-(difluoromethyl)quinazolin-4-yl]amino]methyl]oxetan-3-yl]methanol |
| SMILES | OCC1(CNc2nc(C(F)F)nc3ccccc23)COC1 |
| InChI | InChI=1S/C14H15F2N3O2/c15-11(16)13-18-10-4-2-1-3-9(10)12(19-13)17-5-14(6-20)7-21-8-14/h1-4,11,20H,5-8H2,(H,17,18,19) |
| InChIKey | LYPBSOOFVUUXRX-UHFFFAOYSA-N |
| XLogP | 1.99 |
| TPSA | 67.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.29 |
| LogP ≤ 5 | 1.99 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |