C22H24F2N4O — CID 56553723
2-(difluoromethyl)-N-[2-(2-methoxyphenyl)-2-pyrrolidin-1-ylethyl]quinazolin-4-amine (PubChem CID 56553723) has the molecular formula C22H24F2N4O and a molecular weight of 398.46 g/mol. Its IUPAC name is 2-(difluoromethyl)-N-[2-(2-methoxyphenyl)-2-pyrrolidin-1-ylethyl]quinazolin-4-amine.
| Compound Name | 2-(difluoromethyl)-N-[2-(2-methoxyphenyl)-2-pyrrolidin-1-ylethyl]quinazolin-4-amine |
|---|---|
| PubChem CID | 56553723 |
| Molecular Formula | C22H24F2N4O |
| Molecular Weight | 398.46 g/mol |
| Exact Mass | 398.19 |
| IUPAC Name | 2-(difluoromethyl)-N-[2-(2-methoxyphenyl)-2-pyrrolidin-1-ylethyl]quinazolin-4-amine |
| SMILES | COc1ccccc1C(CNc1nc(C(F)F)nc2ccccc12)N1CCCC1 |
| InChI | InChI=1S/C22H24F2N4O/c1-29-19-11-5-3-9-16(19)18(28-12-6-7-13-28)14-25-21-15-8-2-4-10-17(15)26-22(27-21)20(23)24/h2-5,8-11,18,20H,6-7,12-14H2,1H3,(H,25,26,27) |
| InChIKey | PVEDAYMIABZGFU-UHFFFAOYSA-N |
| XLogP | 4.82 |
| TPSA | 50.28 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.46 |
| LogP ≤ 5 | 4.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |