C18H19F4N3O — CID 133370616
2,3,5,6-tetrafluoro-N-[2-(2-methoxyphenyl)-2-pyrrolidin-1-ylethyl]pyridin-4-amine (PubChem CID 133370616) has the molecular formula C18H19F4N3O and a molecular weight of 369.36 g/mol. Its IUPAC name is 2,3,5,6-tetrafluoro-N-[2-(2-methoxyphenyl)-2-pyrrolidin-1-ylethyl]pyridin-4-amine.
| Compound Name | 2,3,5,6-tetrafluoro-N-[2-(2-methoxyphenyl)-2-pyrrolidin-1-ylethyl]pyridin-4-amine |
|---|---|
| PubChem CID | 133370616 |
| Molecular Formula | C18H19F4N3O |
| Molecular Weight | 369.36 g/mol |
| Exact Mass | 369.15 |
| IUPAC Name | 2,3,5,6-tetrafluoro-N-[2-(2-methoxyphenyl)-2-pyrrolidin-1-ylethyl]pyridin-4-amine |
| SMILES | COc1ccccc1C(CNc1c(F)c(F)nc(F)c1F)N1CCCC1 |
| InChI | InChI=1S/C18H19F4N3O/c1-26-13-7-3-2-6-11(13)12(25-8-4-5-9-25)10-23-16-14(19)17(21)24-18(22)15(16)20/h2-3,6-7,12H,4-5,8-10H2,1H3,(H,23,24) |
| InChIKey | OSBUENOTWRXDFL-UHFFFAOYSA-N |
| XLogP | 3.90 |
| TPSA | 37.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.36 |
| LogP ≤ 5 | 3.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|