C18H22F2N4O — CID 133381147
2-(difluoromethyl)-N-[1-(oxolan-3-yl)piperidin-4-yl]quinazolin-4-amine (PubChem CID 133381147) has the molecular formula C18H22F2N4O and a molecular weight of 348.40 g/mol. Its IUPAC name is 2-(difluoromethyl)-N-[1-(oxolan-3-yl)piperidin-4-yl]quinazolin-4-amine.
| Compound Name | 2-(difluoromethyl)-N-[1-(oxolan-3-yl)piperidin-4-yl]quinazolin-4-amine |
|---|---|
| PubChem CID | 133381147 |
| Molecular Formula | C18H22F2N4O |
| Molecular Weight | 348.40 g/mol |
| Exact Mass | 348.18 |
| IUPAC Name | 2-(difluoromethyl)-N-[1-(oxolan-3-yl)piperidin-4-yl]quinazolin-4-amine |
| SMILES | FC(F)c1nc(NC2CCN(C3CCOC3)CC2)c2ccccc2n1 |
| InChI | InChI=1S/C18H22F2N4O/c19-16(20)18-22-15-4-2-1-3-14(15)17(23-18)21-12-5-8-24(9-6-12)13-7-10-25-11-13/h1-4,12-13,16H,5-11H2,(H,21,22,23) |
| InChIKey | ORZJJDPBFLVAIJ-UHFFFAOYSA-N |
| XLogP | 3.23 |
| TPSA | 50.28 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.40 |
| LogP ≤ 5 | 3.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |