C20H17N3S — CID 91964365
N-(2,4-dimethylphenyl)-2-thiophen-2-ylquinazolin-4-amine (PubChem CID 91964365) has the molecular formula C20H17N3S and a molecular weight of 331.44 g/mol. Its IUPAC name is N-(2,4-dimethylphenyl)-2-thiophen-2-ylquinazolin-4-amine.
| Compound Name | N-(2,4-dimethylphenyl)-2-thiophen-2-ylquinazolin-4-amine |
|---|---|
| PubChem CID | 91964365 |
| Molecular Formula | C20H17N3S |
| Molecular Weight | 331.44 g/mol |
| Exact Mass | 331.11 |
| IUPAC Name | N-(2,4-dimethylphenyl)-2-thiophen-2-ylquinazolin-4-amine |
| SMILES | Cc1ccc(Nc2nc(-c3cccs3)nc3ccccc23)c(C)c1 |
| InChI | InChI=1S/C20H17N3S/c1-13-9-10-16(14(2)12-13)21-19-15-6-3-4-7-17(15)22-20(23-19)18-8-5-11-24-18/h3-12H,1-2H3,(H,21,22,23) |
| InChIKey | QHVOKGGMWQZSRJ-UHFFFAOYSA-N |
| XLogP | 5.72 |
| TPSA | 37.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.44 |
| LogP ≤ 5 | 5.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |