C17H12N4O2S — CID 15435237
3-methyl-1-[(2-thiophen-2-ylquinazolin-4-yl)amino]pyrrole-2,5-dione (PubChem CID 15435237) has the molecular formula C17H12N4O2S and a molecular weight of 336.38 g/mol. Its IUPAC name is 3-methyl-1-[(2-thiophen-2-ylquinazolin-4-yl)amino]pyrrole-2,5-dione.
| Compound Name | 3-methyl-1-[(2-thiophen-2-ylquinazolin-4-yl)amino]pyrrole-2,5-dione |
|---|---|
| PubChem CID | 15435237 |
| Molecular Formula | C17H12N4O2S |
| Molecular Weight | 336.38 g/mol |
| Exact Mass | 336.07 |
| IUPAC Name | 3-methyl-1-[(2-thiophen-2-ylquinazolin-4-yl)amino]pyrrole-2,5-dione |
| SMILES | CC1=CC(=O)N(Nc2nc(-c3cccs3)nc3ccccc23)C1=O |
| InChI | InChI=1S/C17H12N4O2S/c1-10-9-14(22)21(17(10)23)20-15-11-5-2-3-6-12(11)18-16(19-15)13-7-4-8-24-13/h2-9H,1H3,(H,18,19,20) |
| InChIKey | SRSVTFJNRBAZHP-UHFFFAOYSA-N |
| XLogP | 3.00 |
| TPSA | 75.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.38 |
| LogP ≤ 5 | 3.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|