C21H20N6O3S2 — CID 118464650
4-[(3-methyl-2,5-dioxopyrrol-1-yl)amino]-N-piperidin-4-yl-2-thiophen-2-ylthieno[2,3-d]pyrimidine-5-carboxamide (PubChem CID 118464650) has the molecular formula C21H20N6O3S2 and a molecular weight of 468.56 g/mol. Its IUPAC name is 4-[(3-methyl-2,5-dioxopyrrol-1-yl)amino]-N-piperidin-4-yl-2-thiophen-2-ylthieno[2,3-d]pyrimidine-5-carboxamide.
| Compound Name | 4-[(3-methyl-2,5-dioxopyrrol-1-yl)amino]-N-piperidin-4-yl-2-thiophen-2-ylthieno[2,3-d]pyrimidine-5-carboxamide |
|---|---|
| PubChem CID | 118464650 |
| Molecular Formula | C21H20N6O3S2 |
| Molecular Weight | 468.56 g/mol |
| Exact Mass | 468.10 |
| IUPAC Name | 4-[(3-methyl-2,5-dioxopyrrol-1-yl)amino]-N-piperidin-4-yl-2-thiophen-2-ylthieno[2,3-d]pyrimidine-5-carboxamide |
| SMILES | CC1=CC(=O)N(Nc2nc(-c3cccs3)nc3scc(C(=O)NC4CCNCC4)c23)C1=O |
| InChI | InChI=1S/C21H20N6O3S2/c1-11-9-15(28)27(21(11)30)26-18-16-13(19(29)23-12-4-6-22-7-5-12)10-32-20(16)25-17(24-18)14-3-2-8-31-14/h2-3,8-10,12,22H,4-7H2,1H3,(H,23,29)(H,24,25,26) |
| InChIKey | JHERJFQFFGZFPP-UHFFFAOYSA-N |
| XLogP | 2.54 |
| TPSA | 116.32 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 468.56 |
| LogP ≤ 5 | 2.54 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|