C18H14N4O2S2 — CID 24899432
1-[(2-cyclopropyl-5-thiophen-2-ylthieno[2,3-d]pyrimidin-4-yl)amino]-3-methylpyrrole-2,5-dione (PubChem CID 24899432) has the molecular formula C18H14N4O2S2 and a molecular weight of 382.47 g/mol. Its IUPAC name is 1-[(2-cyclopropyl-5-thiophen-2-ylthieno[2,3-d]pyrimidin-4-yl)amino]-3-methylpyrrole-2,5-dione.
| Compound Name | 1-[(2-cyclopropyl-5-thiophen-2-ylthieno[2,3-d]pyrimidin-4-yl)amino]-3-methylpyrrole-2,5-dione |
|---|---|
| PubChem CID | 24899432 |
| Molecular Formula | C18H14N4O2S2 |
| Molecular Weight | 382.47 g/mol |
| Exact Mass | 382.06 |
| IUPAC Name | 1-[(2-cyclopropyl-5-thiophen-2-ylthieno[2,3-d]pyrimidin-4-yl)amino]-3-methylpyrrole-2,5-dione |
| SMILES | CC1=CC(=O)N(Nc2nc(C3CC3)nc3scc(-c4cccs4)c23)C1=O |
| InChI | InChI=1S/C18H14N4O2S2/c1-9-7-13(23)22(18(9)24)21-16-14-11(12-3-2-6-25-12)8-26-17(14)20-15(19-16)10-4-5-10/h2-3,6-8,10H,4-5H2,1H3,(H,19,20,21) |
| InChIKey | QMBSFOUMSVMKGZ-UHFFFAOYSA-N |
| XLogP | 3.94 |
| TPSA | 75.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.47 |
| LogP ≤ 5 | 3.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|