C22H20N4O3S2 — CID 143535520
1-[[2-[(2Z,4E)-4-methoxyhexa-2,4-dienyl]-5-thiophen-2-ylthieno[2,3-d]pyrimidin-4-yl]amino]-3-methylpyrrole-2,5-dione (PubChem CID 143535520) has the molecular formula C22H20N4O3S2 and a molecular weight of 452.56 g/mol. Its IUPAC name is 1-[[2-[(2Z,4E)-4-methoxyhexa-2,4-dienyl]-5-thiophen-2-ylthieno[2,3-d]pyrimidin-4-yl]amino]-3-methylpyrrole-2,5-dione.
| Compound Name | 1-[[2-[(2Z,4E)-4-methoxyhexa-2,4-dienyl]-5-thiophen-2-ylthieno[2,3-d]pyrimidin-4-yl]amino]-3-methylpyrrole-2,5-dione |
|---|---|
| PubChem CID | 143535520 |
| Molecular Formula | C22H20N4O3S2 |
| Molecular Weight | 452.56 g/mol |
| Exact Mass | 452.10 |
| IUPAC Name | 1-[[2-[(2Z,4E)-4-methoxyhexa-2,4-dienyl]-5-thiophen-2-ylthieno[2,3-d]pyrimidin-4-yl]amino]-3-methylpyrrole-2,5-dione |
| SMILES | C/C=C(\C=C/Cc1nc(NN2C(=O)C=C(C)C2=O)c2c(-c3cccs3)csc2n1)OC |
| InChI | InChI=1S/C22H20N4O3S2/c1-4-14(29-3)7-5-9-17-23-20(25-26-18(27)11-13(2)22(26)28)19-15(12-31-21(19)24-17)16-8-6-10-30-16/h4-8,10-12H,9H2,1-3H3,(H,23,24,25)/b7-5-,14-4+ |
| InChIKey | IKABEUSPJVBPEF-HTIFBLFKSA-N |
| XLogP | 4.71 |
| TPSA | 84.42 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 452.56 |
| LogP ≤ 5 | 4.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|