C18H20N8 — CID 138486963
2-N-[(E)-cyclohexa-1,5-dien-1-ylmethylideneamino]-4-N-[(E)-(4-methylphenyl)methylideneamino]-1,3,5-triazine-2,4,6-triamine (PubChem CID 138486963) has the molecular formula C18H20N8 and a molecular weight of 348.41 g/mol. Its IUPAC name is 2-N-[(E)-cyclohexa-1,5-dien-1-ylmethylideneamino]-4-N-[(E)-(4-methylphenyl)methylideneamino]-1,3,5-triazine-2,4,6-triamine.
| Compound Name | 2-N-[(E)-cyclohexa-1,5-dien-1-ylmethylideneamino]-4-N-[(E)-(4-methylphenyl)methylideneamino]-1,3,5-triazine-2,4,6-triamine |
|---|---|
| PubChem CID | 138486963 |
| Molecular Formula | C18H20N8 |
| Molecular Weight | 348.41 g/mol |
| Exact Mass | 348.18 |
| IUPAC Name | 2-N-[(E)-cyclohexa-1,5-dien-1-ylmethylideneamino]-4-N-[(E)-(4-methylphenyl)methylideneamino]-1,3,5-triazine-2,4,6-triamine |
| SMILES | Cc1ccc(/C=N/Nc2nc(N)nc(N/N=C/C3=CCCC=C3)n2)cc1 |
| InChI | InChI=1S/C18H20N8/c1-13-7-9-15(10-8-13)12-21-26-18-23-16(19)22-17(24-18)25-20-11-14-5-3-2-4-6-14/h3,5-12H,2,4H2,1H3,(H4,19,22,23,24,25,26)/b20-11+,21-12+ |
| InChIKey | SYFJMZMXBUNVPL-HGEIODPWSA-N |
| XLogP | 2.88 |
| TPSA | 113.47 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.41 |
| LogP ≤ 5 | 2.88 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|