C25H22N4O — CID 154071636
4-[[[4,6-bis(4-methylphenyl)pyrimidin-2-yl]hydrazinylidene]methyl]phenol (PubChem CID 154071636) has the molecular formula C25H22N4O and a molecular weight of 394.48 g/mol. Its IUPAC name is 4-[[[4,6-bis(4-methylphenyl)pyrimidin-2-yl]hydrazinylidene]methyl]phenol.
| Compound Name | 4-[[[4,6-bis(4-methylphenyl)pyrimidin-2-yl]hydrazinylidene]methyl]phenol |
|---|---|
| PubChem CID | 154071636 |
| Molecular Formula | C25H22N4O |
| Molecular Weight | 394.48 g/mol |
| Exact Mass | 394.18 |
| IUPAC Name | 4-[[[4,6-bis(4-methylphenyl)pyrimidin-2-yl]hydrazinylidene]methyl]phenol |
| SMILES | Cc1ccc(-c2cc(-c3ccc(C)cc3)nc(NN=Cc3ccc(O)cc3)n2)cc1 |
| InChI | InChI=1S/C25H22N4O/c1-17-3-9-20(10-4-17)23-15-24(21-11-5-18(2)6-12-21)28-25(27-23)29-26-16-19-7-13-22(30)14-8-19/h3-16,30H,1-2H3,(H,27,28,29) |
| InChIKey | RXPZLJQJVKJVPZ-UHFFFAOYSA-N |
| XLogP | 5.58 |
| TPSA | 70.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.48 |
| LogP ≤ 5 | 5.58 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hzone_phenol_B(215)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|