C24H19FN4 — CID 2842311
N-[(4-fluorophenyl)methylideneamino]-4-(4-methylphenyl)-6-phenylpyrimidin-2-amine (PubChem CID 2842311) has the molecular formula C24H19FN4 and a molecular weight of 382.44 g/mol. Its IUPAC name is N-[(4-fluorophenyl)methylideneamino]-4-(4-methylphenyl)-6-phenylpyrimidin-2-amine.
| Compound Name | N-[(4-fluorophenyl)methylideneamino]-4-(4-methylphenyl)-6-phenylpyrimidin-2-amine |
|---|---|
| PubChem CID | 2842311 |
| Molecular Formula | C24H19FN4 |
| Molecular Weight | 382.44 g/mol |
| Exact Mass | 382.16 |
| IUPAC Name | N-[(4-fluorophenyl)methylideneamino]-4-(4-methylphenyl)-6-phenylpyrimidin-2-amine |
| SMILES | Cc1ccc(-c2cc(-c3ccccc3)nc(NN=Cc3ccc(F)cc3)n2)cc1 |
| InChI | InChI=1S/C24H19FN4/c1-17-7-11-20(12-8-17)23-15-22(19-5-3-2-4-6-19)27-24(28-23)29-26-16-18-9-13-21(25)14-10-18/h2-16H,1H3,(H,27,28,29) |
| InChIKey | XEYZJWQHTWLEOK-UHFFFAOYSA-N |
| XLogP | 5.70 |
| TPSA | 50.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.44 |
| LogP ≤ 5 | 5.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|