C24H20ClN5 — CID 58065252
2-N-(4-chlorophenyl)-4-N-[(E)-(4-methylphenyl)methylideneamino]-6-phenylpyrimidine-2,4-diamine (PubChem CID 58065252) has the molecular formula C24H20ClN5 and a molecular weight of 413.91 g/mol. Its IUPAC name is 2-N-(4-chlorophenyl)-4-N-[(E)-(4-methylphenyl)methylideneamino]-6-phenylpyrimidine-2,4-diamine.
| Compound Name | 2-N-(4-chlorophenyl)-4-N-[(E)-(4-methylphenyl)methylideneamino]-6-phenylpyrimidine-2,4-diamine |
|---|---|
| PubChem CID | 58065252 |
| Molecular Formula | C24H20ClN5 |
| Molecular Weight | 413.91 g/mol |
| Exact Mass | 413.14 |
| IUPAC Name | 2-N-(4-chlorophenyl)-4-N-[(E)-(4-methylphenyl)methylideneamino]-6-phenylpyrimidine-2,4-diamine |
| SMILES | Cc1ccc(/C=N/Nc2cc(-c3ccccc3)nc(Nc3ccc(Cl)cc3)n2)cc1 |
| InChI | InChI=1S/C24H20ClN5/c1-17-7-9-18(10-8-17)16-26-30-23-15-22(19-5-3-2-4-6-19)28-24(29-23)27-21-13-11-20(25)12-14-21/h2-16H,1H3,(H2,27,28,29,30)/b26-16+ |
| InChIKey | UIPAEDABUCYDBH-WGOQTCKBSA-N |
| XLogP | 6.30 |
| TPSA | 62.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.91 |
| LogP ≤ 5 | 6.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|