C24H22N6 — CID 71482556
1-N,4-N-bis[(E)-(4-methylphenyl)methylideneamino]phthalazine-1,4-diamine (PubChem CID 71482556) has the molecular formula C24H22N6 and a molecular weight of 394.48 g/mol. Its IUPAC name is 1-N,4-N-bis[(E)-(4-methylphenyl)methylideneamino]phthalazine-1,4-diamine.
| Compound Name | 1-N,4-N-bis[(E)-(4-methylphenyl)methylideneamino]phthalazine-1,4-diamine |
|---|---|
| PubChem CID | 71482556 |
| Molecular Formula | C24H22N6 |
| Molecular Weight | 394.48 g/mol |
| Exact Mass | 394.19 |
| IUPAC Name | 1-N,4-N-bis[(E)-(4-methylphenyl)methylideneamino]phthalazine-1,4-diamine |
| SMILES | Cc1ccc(/C=N/Nc2nnc(N/N=C/c3ccc(C)cc3)c3ccccc23)cc1 |
| InChI | InChI=1S/C24H22N6/c1-17-7-11-19(12-8-17)15-25-27-23-21-5-3-4-6-22(21)24(30-29-23)28-26-16-20-13-9-18(2)10-14-20/h3-16H,1-2H3,(H,27,29)(H,28,30)/b25-15+,26-16+ |
| InChIKey | XTIALRQUUXTLOG-RYQLWAFASA-N |
| XLogP | 5.14 |
| TPSA | 74.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.48 |
| LogP ≤ 5 | 5.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|