C25H28Cl2N8O — CID 86279269
1-[2-amino-6-[(2E)-2-[(4-chlorophenyl)methylidene]hydrazinyl]pyrimidin-4-yl]-1-[(E)-(4-chlorophenyl)methylideneamino]-3-hexylurea (PubChem CID 86279269) has the molecular formula C25H28Cl2N8O and a molecular weight of 527.46 g/mol. Its IUPAC name is 1-[2-amino-6-[(2E)-2-[(4-chlorophenyl)methylidene]hydrazinyl]pyrimidin-4-yl]-1-[(E)-(4-chlorophenyl)methylideneamino]-3-hexylurea.
| Compound Name | 1-[2-amino-6-[(2E)-2-[(4-chlorophenyl)methylidene]hydrazinyl]pyrimidin-4-yl]-1-[(E)-(4-chlorophenyl)methylideneamino]-3-hexylurea |
|---|---|
| PubChem CID | 86279269 |
| Molecular Formula | C25H28Cl2N8O |
| Molecular Weight | 527.46 g/mol |
| Exact Mass | 526.18 |
| IUPAC Name | 1-[2-amino-6-[(2E)-2-[(4-chlorophenyl)methylidene]hydrazinyl]pyrimidin-4-yl]-1-[(E)-(4-chlorophenyl)methylideneamino]-3-hexylurea |
| SMILES | CCCCCCNC(=O)N(/N=C/c1ccc(Cl)cc1)c1cc(N/N=C/c2ccc(Cl)cc2)nc(N)n1 |
| InChI | InChI=1S/C25H28Cl2N8O/c1-2-3-4-5-14-29-25(36)35(31-17-19-8-12-21(27)13-9-19)23-15-22(32-24(28)33-23)34-30-16-18-6-10-20(26)11-7-18/h6-13,15-17H,2-5,14H2,1H3,(H,29,36)(H3,28,32,33,34)/b30-16+,31-17+ |
| InChIKey | FEKWUEKXUFGMHI-RVSCTIAXSA-N |
| XLogP | 5.94 |
| TPSA | 120.89 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 527.46 |
| LogP ≤ 5 | 5.94 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|