C14H11Cl3N2 — CID 6050977
2,4,6-trichloro-N-[(Z)-(4-methylphenyl)methylideneamino]aniline (PubChem CID 6050977) has the molecular formula C14H11Cl3N2 and a molecular weight of 313.62 g/mol. Its IUPAC name is 2,4,6-trichloro-N-[(Z)-(4-methylphenyl)methylideneamino]aniline.
| Compound Name | 2,4,6-trichloro-N-[(Z)-(4-methylphenyl)methylideneamino]aniline |
|---|---|
| PubChem CID | 6050977 |
| Molecular Formula | C14H11Cl3N2 |
| Molecular Weight | 313.62 g/mol |
| Exact Mass | 312.00 |
| IUPAC Name | 2,4,6-trichloro-N-[(Z)-(4-methylphenyl)methylideneamino]aniline |
| SMILES | Cc1ccc(/C=N\Nc2c(Cl)cc(Cl)cc2Cl)cc1 |
| InChI | InChI=1S/C14H11Cl3N2/c1-9-2-4-10(5-3-9)8-18-19-14-12(16)6-11(15)7-13(14)17/h2-8,19H,1H3/b18-8- |
| InChIKey | NEZAKLIDLWQJBI-LSCVHKIXSA-N |
| XLogP | 5.40 |
| TPSA | 24.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.62 |
| LogP ≤ 5 | 5.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|