C26H30Cl4N8 — CID 98574411
4-N-[(E)-[4-[bis(2-chloroethyl)amino]phenyl]methylideneamino]-2-N-[(Z)-[4-[bis(2-chloroethyl)amino]phenyl]methylideneamino]pyrimidine-2,4-diamine (PubChem CID 98574411) has the molecular formula C26H30Cl4N8 and a molecular weight of 596.39 g/mol. Its IUPAC name is 4-N-[(E)-[4-[bis(2-chloroethyl)amino]phenyl]methylideneamino]-2-N-[(Z)-[4-[bis(2-chloroethyl)amino]phenyl]methylideneamino]pyrimidine-2,4-diamine.
| Compound Name | 4-N-[(E)-[4-[bis(2-chloroethyl)amino]phenyl]methylideneamino]-2-N-[(Z)-[4-[bis(2-chloroethyl)amino]phenyl]methylideneamino]pyrimidine-2,4-diamine |
|---|---|
| PubChem CID | 98574411 |
| Molecular Formula | C26H30Cl4N8 |
| Molecular Weight | 596.39 g/mol |
| Exact Mass | 594.13 |
| IUPAC Name | 4-N-[(E)-[4-[bis(2-chloroethyl)amino]phenyl]methylideneamino]-2-N-[(Z)-[4-[bis(2-chloroethyl)amino]phenyl]methylideneamino]pyrimidine-2,4-diamine |
| SMILES | ClCCN(CCCl)c1ccc(/C=N\Nc2nccc(N/N=C/c3ccc(N(CCCl)CCCl)cc3)n2)cc1 |
| InChI | InChI=1S/C26H30Cl4N8/c27-10-15-37(16-11-28)23-5-1-21(2-6-23)19-32-35-25-9-14-31-26(34-25)36-33-20-22-3-7-24(8-4-22)38(17-12-29)18-13-30/h1-9,14,19-20H,10-13,15-18H2,(H2,31,34,35,36)/b32-19+,33-20- |
| InChIKey | ASNHZFHNZPSPTK-LFMVBXFPSA-N |
| XLogP | 5.94 |
| TPSA | 81.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 596.39 |
| LogP ≤ 5 | 5.94 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'hzone_anil_di_alk(35)', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|