C34H30N10+2 — CID 5478013
2-N,4-N-bis[(Z)-[4-(1-methylimidazo[1,2-a]pyridin-1-ium-2-yl)phenyl]methylideneamino]pyrimidine-2,4-diamine (PubChem CID 5478013) has the molecular formula C34H30N10+2 and a molecular weight of 578.68 g/mol. Its IUPAC name is 2-N,4-N-bis[(Z)-[4-(1-methylimidazo[1,2-a]pyridin-1-ium-2-yl)phenyl]methylideneamino]pyrimidine-2,4-diamine.
| Compound Name | 2-N,4-N-bis[(Z)-[4-(1-methylimidazo[1,2-a]pyridin-1-ium-2-yl)phenyl]methylideneamino]pyrimidine-2,4-diamine |
|---|---|
| PubChem CID | 5478013 |
| Molecular Formula | C34H30N10+2 |
| Molecular Weight | 578.68 g/mol |
| Exact Mass | 578.26 |
| IUPAC Name | 2-N,4-N-bis[(Z)-[4-(1-methylimidazo[1,2-a]pyridin-1-ium-2-yl)phenyl]methylideneamino]pyrimidine-2,4-diamine |
| SMILES | C[n+]1c(-c2ccc(/C=N\Nc3ccnc(N/N=C\c4ccc(-c5cn6ccccc6[n+]5C)cc4)n3)cc2)cn2ccccc21 |
| InChI | InChI=1S/C34H30N10/c1-41-29(23-43-19-5-3-7-32(41)43)27-13-9-25(10-14-27)21-36-39-31-17-18-35-34(38-31)40-37-22-26-11-15-28(16-12-26)30-24-44-20-6-4-8-33(44)42(30)2/h3-24H,1-2H3,(H2,35,38,39,40)/q+2/b36-21-,37-22- |
| InChIKey | BENLPZDVYYNNSX-BWBHXBINSA-N |
| XLogP | 4.86 |
| TPSA | 91.14 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 44 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 578.68 |
| LogP ≤ 5 | 4.86 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|