C11H11N5O — CID 121224099
4-[(2E)-2-benzylidenehydrazinyl]-1-methyl-1,3,5-triazin-2-one (PubChem CID 121224099) has the molecular formula C11H11N5O and a molecular weight of 229.24 g/mol. Its IUPAC name is 4-[(2E)-2-benzylidenehydrazinyl]-1-methyl-1,3,5-triazin-2-one.
| Compound Name | 4-[(2E)-2-benzylidenehydrazinyl]-1-methyl-1,3,5-triazin-2-one |
|---|---|
| PubChem CID | 121224099 |
| Molecular Formula | C11H11N5O |
| Molecular Weight | 229.24 g/mol |
| Exact Mass | 229.10 |
| IUPAC Name | 4-[(2E)-2-benzylidenehydrazinyl]-1-methyl-1,3,5-triazin-2-one |
| SMILES | Cn1cnc(N/N=C/c2ccccc2)nc1=O |
| InChI | InChI=1S/C11H11N5O/c1-16-8-12-10(14-11(16)17)15-13-7-9-5-3-2-4-6-9/h2-8H,1H3,(H,14,15,17)/b13-7+ |
| InChIKey | LVWVVYPNVWWGBV-NTUHNPAUSA-N |
| XLogP | 0.62 |
| TPSA | 72.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 229.24 |
| LogP ≤ 5 | 0.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|