C11H11N5 — CID 121223490
N-[(E)-benzylideneamino]-4-methyl-1,3,5-triazin-2-amine (PubChem CID 121223490) has the molecular formula C11H11N5 and a molecular weight of 213.24 g/mol. Its IUPAC name is N-[(E)-benzylideneamino]-4-methyl-1,3,5-triazin-2-amine.
| Compound Name | N-[(E)-benzylideneamino]-4-methyl-1,3,5-triazin-2-amine |
|---|---|
| PubChem CID | 121223490 |
| Molecular Formula | C11H11N5 |
| Molecular Weight | 213.24 g/mol |
| Exact Mass | 213.10 |
| IUPAC Name | N-[(E)-benzylideneamino]-4-methyl-1,3,5-triazin-2-amine |
| SMILES | Cc1ncnc(N/N=C/c2ccccc2)n1 |
| InChI | InChI=1S/C11H11N5/c1-9-12-8-13-11(15-9)16-14-7-10-5-3-2-4-6-10/h2-8H,1H3,(H,12,13,15,16)/b14-7+ |
| InChIKey | YUKVJGBEOXAVKV-VGOFMYFVSA-N |
| XLogP | 1.63 |
| TPSA | 63.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 213.24 |
| LogP ≤ 5 | 1.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|