C17H10F5N5O — CID 174960191
4-(2,6-difluorophenyl)-N-[[4-(trifluoromethoxy)phenyl]methylideneamino]-1,3,5-triazin-2-amine (PubChem CID 174960191) has the molecular formula C17H10F5N5O and a molecular weight of 395.29 g/mol. Its IUPAC name is 4-(2,6-difluorophenyl)-N-[[4-(trifluoromethoxy)phenyl]methylideneamino]-1,3,5-triazin-2-amine.
| Compound Name | 4-(2,6-difluorophenyl)-N-[[4-(trifluoromethoxy)phenyl]methylideneamino]-1,3,5-triazin-2-amine |
|---|---|
| PubChem CID | 174960191 |
| Molecular Formula | C17H10F5N5O |
| Molecular Weight | 395.29 g/mol |
| Exact Mass | 395.08 |
| IUPAC Name | 4-(2,6-difluorophenyl)-N-[[4-(trifluoromethoxy)phenyl]methylideneamino]-1,3,5-triazin-2-amine |
| SMILES | Fc1cccc(F)c1-c1ncnc(NN=Cc2ccc(OC(F)(F)F)cc2)n1 |
| InChI | InChI=1S/C17H10F5N5O/c18-12-2-1-3-13(19)14(12)15-23-9-24-16(26-15)27-25-8-10-4-6-11(7-5-10)28-17(20,21)22/h1-9H,(H,23,24,26,27) |
| InChIKey | HJXBXEQVLSQEGA-UHFFFAOYSA-N |
| XLogP | 4.16 |
| TPSA | 72.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.29 |
| LogP ≤ 5 | 4.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|