C19H16ClF4N7O — CID 66679399
4-N-(2-aminoethyl)-6-(2-chloro-6-fluorophenyl)-2-N-[[4-(trifluoromethoxy)phenyl]methylideneamino]-1,3,5-triazine-2,4-diamine (PubChem CID 66679399) has the molecular formula C19H16ClF4N7O and a molecular weight of 469.83 g/mol. Its IUPAC name is 4-N-(2-aminoethyl)-6-(2-chloro-6-fluorophenyl)-2-N-[[4-(trifluoromethoxy)phenyl]methylideneamino]-1,3,5-triazine-2,4-diamine.
| Compound Name | 4-N-(2-aminoethyl)-6-(2-chloro-6-fluorophenyl)-2-N-[[4-(trifluoromethoxy)phenyl]methylideneamino]-1,3,5-triazine-2,4-diamine |
|---|---|
| PubChem CID | 66679399 |
| Molecular Formula | C19H16ClF4N7O |
| Molecular Weight | 469.83 g/mol |
| Exact Mass | 469.10 |
| IUPAC Name | 4-N-(2-aminoethyl)-6-(2-chloro-6-fluorophenyl)-2-N-[[4-(trifluoromethoxy)phenyl]methylideneamino]-1,3,5-triazine-2,4-diamine |
| SMILES | NCCNc1nc(NN=Cc2ccc(OC(F)(F)F)cc2)nc(-c2c(F)cccc2Cl)n1 |
| InChI | InChI=1S/C19H16ClF4N7O/c20-13-2-1-3-14(21)15(13)16-28-17(26-9-8-25)30-18(29-16)31-27-10-11-4-6-12(7-5-11)32-19(22,23)24/h1-7,10H,8-9,25H2,(H2,26,28,29,30,31) |
| InChIKey | HBIBZCHEHVSZSE-UHFFFAOYSA-N |
| XLogP | 4.05 |
| TPSA | 110.34 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 469.83 |
| LogP ≤ 5 | 4.05 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|