C23H25ClFN7O — CID 58065266
6-(2-chloro-6-fluorophenyl)-2-N-[(E)-(4-methylphenyl)methylideneamino]-4-N-(2-morpholin-4-ylethyl)-1,3,5-triazine-2,4-diamine (PubChem CID 58065266) has the molecular formula C23H25ClFN7O and a molecular weight of 469.95 g/mol. Its IUPAC name is 6-(2-chloro-6-fluorophenyl)-2-N-[(E)-(4-methylphenyl)methylideneamino]-4-N-(2-morpholin-4-ylethyl)-1,3,5-triazine-2,4-diamine.
| Compound Name | 6-(2-chloro-6-fluorophenyl)-2-N-[(E)-(4-methylphenyl)methylideneamino]-4-N-(2-morpholin-4-ylethyl)-1,3,5-triazine-2,4-diamine |
|---|---|
| PubChem CID | 58065266 |
| Molecular Formula | C23H25ClFN7O |
| Molecular Weight | 469.95 g/mol |
| Exact Mass | 469.18 |
| IUPAC Name | 6-(2-chloro-6-fluorophenyl)-2-N-[(E)-(4-methylphenyl)methylideneamino]-4-N-(2-morpholin-4-ylethyl)-1,3,5-triazine-2,4-diamine |
| SMILES | Cc1ccc(/C=N/Nc2nc(NCCN3CCOCC3)nc(-c3c(F)cccc3Cl)n2)cc1 |
| InChI | InChI=1S/C23H25ClFN7O/c1-16-5-7-17(8-6-16)15-27-31-23-29-21(20-18(24)3-2-4-19(20)25)28-22(30-23)26-9-10-32-11-13-33-14-12-32/h2-8,15H,9-14H2,1H3,(H2,26,28,29,30,31)/b27-15+ |
| InChIKey | HHLCMRUCYGPCAG-JFLMPSFJSA-N |
| XLogP | 3.83 |
| TPSA | 87.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 469.95 |
| LogP ≤ 5 | 3.83 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|