C23H13Cl3F4N6O — CID 88580134
6-(2-chloro-6-fluorophenyl)-4-N-(3,4-dichlorophenyl)-2-N-[(E)-[4-(trifluoromethoxy)phenyl]methylideneamino]-1,3,5-triazine-2,4-diamine (PubChem CID 88580134) has the molecular formula C23H13Cl3F4N6O and a molecular weight of 571.75 g/mol. Its IUPAC name is 6-(2-chloro-6-fluorophenyl)-4-N-(3,4-dichlorophenyl)-2-N-[(E)-[4-(trifluoromethoxy)phenyl]methylideneamino]-1,3,5-triazine-2,4-diamine.
| Compound Name | 6-(2-chloro-6-fluorophenyl)-4-N-(3,4-dichlorophenyl)-2-N-[(E)-[4-(trifluoromethoxy)phenyl]methylideneamino]-1,3,5-triazine-2,4-diamine |
|---|---|
| PubChem CID | 88580134 |
| Molecular Formula | C23H13Cl3F4N6O |
| Molecular Weight | 571.75 g/mol |
| Exact Mass | 570.02 |
| IUPAC Name | 6-(2-chloro-6-fluorophenyl)-4-N-(3,4-dichlorophenyl)-2-N-[(E)-[4-(trifluoromethoxy)phenyl]methylideneamino]-1,3,5-triazine-2,4-diamine |
| SMILES | Fc1cccc(Cl)c1-c1nc(N/N=C/c2ccc(OC(F)(F)F)cc2)nc(Nc2ccc(Cl)c(Cl)c2)n1 |
| InChI | InChI=1S/C23H13Cl3F4N6O/c24-15-9-6-13(10-17(15)26)32-21-33-20(19-16(25)2-1-3-18(19)27)34-22(35-21)36-31-11-12-4-7-14(8-5-12)37-23(28,29)30/h1-11H,(H2,32,33,34,35,36)/b31-11+ |
| InChIKey | JRGLIJHQIRPZRO-QFDQHJFZSA-N |
| XLogP | 7.73 |
| TPSA | 84.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 571.75 |
| LogP ≤ 5 | 7.73 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|