C23H15Cl2F4N7O — CID 86661469
6-(2-chloro-6-fluorophenyl)-4-N-[(6-chloro-3-pyridinyl)methyl]-2-N-[[4-(trifluoromethoxy)phenyl]methylideneamino]-1,3,5-triazine-2,4-diamine (PubChem CID 86661469) has the molecular formula C23H15Cl2F4N7O and a molecular weight of 552.32 g/mol. Its IUPAC name is 6-(2-chloro-6-fluorophenyl)-4-N-[(6-chloro-3-pyridinyl)methyl]-2-N-[[4-(trifluoromethoxy)phenyl]methylideneamino]-1,3,5-triazine-2,4-diamine.
| Compound Name | 6-(2-chloro-6-fluorophenyl)-4-N-[(6-chloro-3-pyridinyl)methyl]-2-N-[[4-(trifluoromethoxy)phenyl]methylideneamino]-1,3,5-triazine-2,4-diamine |
|---|---|
| PubChem CID | 86661469 |
| Molecular Formula | C23H15Cl2F4N7O |
| Molecular Weight | 552.32 g/mol |
| Exact Mass | 551.07 |
| IUPAC Name | 6-(2-chloro-6-fluorophenyl)-4-N-[(6-chloro-3-pyridinyl)methyl]-2-N-[[4-(trifluoromethoxy)phenyl]methylideneamino]-1,3,5-triazine-2,4-diamine |
| SMILES | Fc1cccc(Cl)c1-c1nc(NCc2ccc(Cl)nc2)nc(NN=Cc2ccc(OC(F)(F)F)cc2)n1 |
| InChI | InChI=1S/C23H15Cl2F4N7O/c24-16-2-1-3-17(26)19(16)20-33-21(31-11-14-6-9-18(25)30-10-14)35-22(34-20)36-32-12-13-4-7-15(8-5-13)37-23(27,28)29/h1-10,12H,11H2,(H2,31,33,34,35,36) |
| InChIKey | RGHYUFCFSKQAHZ-UHFFFAOYSA-N |
| XLogP | 6.34 |
| TPSA | 97.21 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 552.32 |
| LogP ≤ 5 | 6.34 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|