C26H21ClF6N8O — CID 89193216
6-N-[(6-chloro-3-pyridinyl)methyl]-2-N-[(E)-[4-(1,1-difluoroethyl)phenyl]methylideneamino]-4-N-[3-(1,1,2,2-tetrafluoroethoxy)phenyl]-1,3,5-triazine-2,4,6-triamine (PubChem CID 89193216) has the molecular formula C26H21ClF6N8O and a molecular weight of 610.95 g/mol. Its IUPAC name is 6-N-[(6-chloro-3-pyridinyl)methyl]-2-N-[(E)-[4-(1,1-difluoroethyl)phenyl]methylideneamino]-4-N-[3-(1,1,2,2-tetrafluoroethoxy)phenyl]-1,3,5-triazine-2,4,6-triamine.
| Compound Name | 6-N-[(6-chloro-3-pyridinyl)methyl]-2-N-[(E)-[4-(1,1-difluoroethyl)phenyl]methylideneamino]-4-N-[3-(1,1,2,2-tetrafluoroethoxy)phenyl]-1,3,5-triazine-2,4,6-triamine |
|---|---|
| PubChem CID | 89193216 |
| Molecular Formula | C26H21ClF6N8O |
| Molecular Weight | 610.95 g/mol |
| Exact Mass | 610.14 |
| IUPAC Name | 6-N-[(6-chloro-3-pyridinyl)methyl]-2-N-[(E)-[4-(1,1-difluoroethyl)phenyl]methylideneamino]-4-N-[3-(1,1,2,2-tetrafluoroethoxy)phenyl]-1,3,5-triazine-2,4,6-triamine |
| SMILES | CC(F)(F)c1ccc(/C=N/Nc2nc(NCc3ccc(Cl)nc3)nc(Nc3cccc(OC(F)(F)C(F)F)c3)n2)cc1 |
| InChI | InChI=1S/C26H21ClF6N8O/c1-25(30,31)17-8-5-15(6-9-17)14-36-41-24-39-22(35-13-16-7-10-20(27)34-12-16)38-23(40-24)37-18-3-2-4-19(11-18)42-26(32,33)21(28)29/h2-12,14,21H,13H2,1H3,(H3,35,37,38,39,40,41)/b36-14+ |
| InChIKey | LJTYUPANZDQZME-QQMJPZKZSA-N |
| XLogP | 7.07 |
| TPSA | 109.24 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 610.95 |
| LogP ≤ 5 | 7.07 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|