C21H19F6N7O3 — CID 25260696
6-N-(2-methoxyethyl)-4-N-[4-(trifluoromethoxy)phenyl]-2-N-[(E)-[4-(trifluoromethoxy)phenyl]methylideneamino]-1,3,5-triazine-2,4,6-triamine (PubChem CID 25260696) has the molecular formula C21H19F6N7O3 and a molecular weight of 531.42 g/mol. Its IUPAC name is 6-N-(2-methoxyethyl)-4-N-[4-(trifluoromethoxy)phenyl]-2-N-[(E)-[4-(trifluoromethoxy)phenyl]methylideneamino]-1,3,5-triazine-2,4,6-triamine.
| Compound Name | 6-N-(2-methoxyethyl)-4-N-[4-(trifluoromethoxy)phenyl]-2-N-[(E)-[4-(trifluoromethoxy)phenyl]methylideneamino]-1,3,5-triazine-2,4,6-triamine |
|---|---|
| PubChem CID | 25260696 |
| Molecular Formula | C21H19F6N7O3 |
| Molecular Weight | 531.42 g/mol |
| Exact Mass | 531.15 |
| IUPAC Name | 6-N-(2-methoxyethyl)-4-N-[4-(trifluoromethoxy)phenyl]-2-N-[(E)-[4-(trifluoromethoxy)phenyl]methylideneamino]-1,3,5-triazine-2,4,6-triamine |
| SMILES | COCCNc1nc(N/N=C/c2ccc(OC(F)(F)F)cc2)nc(Nc2ccc(OC(F)(F)F)cc2)n1 |
| InChI | InChI=1S/C21H19F6N7O3/c1-35-11-10-28-17-31-18(30-14-4-8-16(9-5-14)37-21(25,26)27)33-19(32-17)34-29-12-13-2-6-15(7-3-13)36-20(22,23)24/h2-9,12H,10-11H2,1H3,(H3,28,30,31,32,33,34)/b29-12+ |
| InChIKey | LDQODUWWACUWCD-XKJRVUDJSA-N |
| XLogP | 4.92 |
| TPSA | 114.81 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 531.42 |
| LogP ≤ 5 | 4.92 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|