C23H23F6N7O2 — CID 143789866
[[4-[(2E)-2-[(4-cyclopropylphenyl)methylidene]hydrazinyl]-6-[4-(trifluoromethoxy)anilino]-1,3,5-triazin-2-yl]amino]methanol;1,1,1-trifluoroethane (PubChem CID 143789866) has the molecular formula C23H23F6N7O2 and a molecular weight of 543.47 g/mol. Its IUPAC name is [[4-[(2E)-2-[(4-cyclopropylphenyl)methylidene]hydrazinyl]-6-[4-(trifluoromethoxy)anilino]-1,3,5-triazin-2-yl]amino]methanol;1,1,1-trifluoroethane.
| Compound Name | [[4-[(2E)-2-[(4-cyclopropylphenyl)methylidene]hydrazinyl]-6-[4-(trifluoromethoxy)anilino]-1,3,5-triazin-2-yl]amino]methanol;1,1,1-trifluoroethane |
|---|---|
| PubChem CID | 143789866 |
| Molecular Formula | C23H23F6N7O2 |
| Molecular Weight | 543.47 g/mol |
| Exact Mass | 543.18 |
| IUPAC Name | [[4-[(2E)-2-[(4-cyclopropylphenyl)methylidene]hydrazinyl]-6-[4-(trifluoromethoxy)anilino]-1,3,5-triazin-2-yl]amino]methanol;1,1,1-trifluoroethane |
| SMILES | CC(F)(F)F.OCNc1nc(N/N=C/c2ccc(C3CC3)cc2)nc(Nc2ccc(OC(F)(F)F)cc2)n1 |
| InChI | InChI=1S/C21H20F3N7O2.C2H3F3/c22-21(23,24)33-17-9-7-16(8-10-17)27-19-28-18(25-12-32)29-20(30-19)31-26-11-13-1-3-14(4-2-13)15-5-6-15;1-2(3,4)5/h1-4,7-11,15,32H,5-6,12H2,(H3,25,27,28,29,30,31);1H3/b26-11+; |
| InChIKey | QCKAONAIAWEOMM-GRLWOBSZSA-N |
| XLogP | 5.77 |
| TPSA | 116.58 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 543.47 |
| LogP ≤ 5 | 5.77 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|