C23H14Cl2F4N6O — CID 58065269
6-(2-chloro-6-fluorophenyl)-4-N-(4-chlorophenyl)-2-N-[(E)-[4-(trifluoromethoxy)phenyl]methylideneamino]-1,3,5-triazine-2,4-diamine (PubChem CID 58065269) has the molecular formula C23H14Cl2F4N6O and a molecular weight of 537.30 g/mol. Its IUPAC name is 6-(2-chloro-6-fluorophenyl)-4-N-(4-chlorophenyl)-2-N-[(E)-[4-(trifluoromethoxy)phenyl]methylideneamino]-1,3,5-triazine-2,4-diamine.
| Compound Name | 6-(2-chloro-6-fluorophenyl)-4-N-(4-chlorophenyl)-2-N-[(E)-[4-(trifluoromethoxy)phenyl]methylideneamino]-1,3,5-triazine-2,4-diamine |
|---|---|
| PubChem CID | 58065269 |
| Molecular Formula | C23H14Cl2F4N6O |
| Molecular Weight | 537.30 g/mol |
| Exact Mass | 536.05 |
| IUPAC Name | 6-(2-chloro-6-fluorophenyl)-4-N-(4-chlorophenyl)-2-N-[(E)-[4-(trifluoromethoxy)phenyl]methylideneamino]-1,3,5-triazine-2,4-diamine |
| SMILES | Fc1cccc(Cl)c1-c1nc(N/N=C/c2ccc(OC(F)(F)F)cc2)nc(Nc2ccc(Cl)cc2)n1 |
| InChI | InChI=1S/C23H14Cl2F4N6O/c24-14-6-8-15(9-7-14)31-21-32-20(19-17(25)2-1-3-18(19)26)33-22(34-21)35-30-12-13-4-10-16(11-5-13)36-23(27,28)29/h1-12H,(H2,31,32,33,34,35)/b30-12+ |
| InChIKey | BPRHZPGHEWXHAR-PNQUVVCRSA-N |
| XLogP | 7.07 |
| TPSA | 84.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 537.30 |
| LogP ≤ 5 | 7.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|