C24H16Cl2F4N6O — CID 87103882
6-(2-chloro-6-fluorophenyl)-4-N-[(4-chlorophenyl)methyl]-2-N-[[4-(trifluoromethoxy)phenyl]methylideneamino]-1,3,5-triazine-2,4-diamine (PubChem CID 87103882) has the molecular formula C24H16Cl2F4N6O and a molecular weight of 551.33 g/mol. Its IUPAC name is 6-(2-chloro-6-fluorophenyl)-4-N-[(4-chlorophenyl)methyl]-2-N-[[4-(trifluoromethoxy)phenyl]methylideneamino]-1,3,5-triazine-2,4-diamine.
| Compound Name | 6-(2-chloro-6-fluorophenyl)-4-N-[(4-chlorophenyl)methyl]-2-N-[[4-(trifluoromethoxy)phenyl]methylideneamino]-1,3,5-triazine-2,4-diamine |
|---|---|
| PubChem CID | 87103882 |
| Molecular Formula | C24H16Cl2F4N6O |
| Molecular Weight | 551.33 g/mol |
| Exact Mass | 550.07 |
| IUPAC Name | 6-(2-chloro-6-fluorophenyl)-4-N-[(4-chlorophenyl)methyl]-2-N-[[4-(trifluoromethoxy)phenyl]methylideneamino]-1,3,5-triazine-2,4-diamine |
| SMILES | Fc1cccc(Cl)c1-c1nc(NCc2ccc(Cl)cc2)nc(NN=Cc2ccc(OC(F)(F)F)cc2)n1 |
| InChI | InChI=1S/C24H16Cl2F4N6O/c25-16-8-4-14(5-9-16)12-31-22-33-21(20-18(26)2-1-3-19(20)27)34-23(35-22)36-32-13-15-6-10-17(11-7-15)37-24(28,29)30/h1-11,13H,12H2,(H2,31,33,34,35,36) |
| InChIKey | GSXKUYKWBCKYIL-UHFFFAOYSA-N |
| XLogP | 6.94 |
| TPSA | 84.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 551.33 |
| LogP ≤ 5 | 6.94 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|