C24H18ClF3N6O2 — CID 87103844
4-N-(4-chlorophenyl)-6-(4-methoxyphenyl)-2-N-[(Z)-[4-(trifluoromethoxy)phenyl]methylideneamino]-1,3,5-triazine-2,4-diamine (PubChem CID 87103844) has the molecular formula C24H18ClF3N6O2 and a molecular weight of 514.90 g/mol. Its IUPAC name is 4-N-(4-chlorophenyl)-6-(4-methoxyphenyl)-2-N-[(Z)-[4-(trifluoromethoxy)phenyl]methylideneamino]-1,3,5-triazine-2,4-diamine.
| Compound Name | 4-N-(4-chlorophenyl)-6-(4-methoxyphenyl)-2-N-[(Z)-[4-(trifluoromethoxy)phenyl]methylideneamino]-1,3,5-triazine-2,4-diamine |
|---|---|
| PubChem CID | 87103844 |
| Molecular Formula | C24H18ClF3N6O2 |
| Molecular Weight | 514.90 g/mol |
| Exact Mass | 514.11 |
| IUPAC Name | 4-N-(4-chlorophenyl)-6-(4-methoxyphenyl)-2-N-[(Z)-[4-(trifluoromethoxy)phenyl]methylideneamino]-1,3,5-triazine-2,4-diamine |
| SMILES | COc1ccc(-c2nc(N/N=C\c3ccc(OC(F)(F)F)cc3)nc(Nc3ccc(Cl)cc3)n2)cc1 |
| InChI | InChI=1S/C24H18ClF3N6O2/c1-35-19-12-4-16(5-13-19)21-31-22(30-18-8-6-17(25)7-9-18)33-23(32-21)34-29-14-15-2-10-20(11-3-15)36-24(26,27)28/h2-14H,1H3,(H2,30,31,32,33,34)/b29-14- |
| InChIKey | SANLHSSYOCMYRT-NUJZUDFISA-N |
| XLogP | 6.29 |
| TPSA | 93.55 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 514.90 |
| LogP ≤ 5 | 6.29 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|