C26H19F3N4O4 — CID 175218686
3-[4-[[4-(4-methoxyphenyl)-6-[4-(trifluoromethoxy)phenyl]-1,3,5-triazin-2-yl]amino]phenyl]prop-2-enoic acid (PubChem CID 175218686) has the molecular formula C26H19F3N4O4 and a molecular weight of 508.46 g/mol. Its IUPAC name is 3-[4-[[4-(4-methoxyphenyl)-6-[4-(trifluoromethoxy)phenyl]-1,3,5-triazin-2-yl]amino]phenyl]prop-2-enoic acid.
| Compound Name | 3-[4-[[4-(4-methoxyphenyl)-6-[4-(trifluoromethoxy)phenyl]-1,3,5-triazin-2-yl]amino]phenyl]prop-2-enoic acid |
|---|---|
| PubChem CID | 175218686 |
| Molecular Formula | C26H19F3N4O4 |
| Molecular Weight | 508.46 g/mol |
| Exact Mass | 508.14 |
| IUPAC Name | 3-[4-[[4-(4-methoxyphenyl)-6-[4-(trifluoromethoxy)phenyl]-1,3,5-triazin-2-yl]amino]phenyl]prop-2-enoic acid |
| SMILES | COc1ccc(-c2nc(Nc3ccc(C=CC(=O)O)cc3)nc(-c3ccc(OC(F)(F)F)cc3)n2)cc1 |
| InChI | InChI=1S/C26H19F3N4O4/c1-36-20-11-5-17(6-12-20)23-31-24(18-7-13-21(14-8-18)37-26(27,28)29)33-25(32-23)30-19-9-2-16(3-10-19)4-15-22(34)35/h2-15H,1H3,(H,34,35)(H,30,31,32,33) |
| InChIKey | AEPVFCIFLZABEH-UHFFFAOYSA-N |
| XLogP | 5.95 |
| TPSA | 106.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 508.46 |
| LogP ≤ 5 | 5.95 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|