C25H16F4N4O2 — CID 166452191
4-[2-(4-fluorophenyl)ethynyl]-6-(4-methoxyphenyl)-N-[4-(trifluoromethoxy)phenyl]-1,3,5-triazin-2-amine (PubChem CID 166452191) has the molecular formula C25H16F4N4O2 and a molecular weight of 480.42 g/mol. Its IUPAC name is 4-[2-(4-fluorophenyl)ethynyl]-6-(4-methoxyphenyl)-N-[4-(trifluoromethoxy)phenyl]-1,3,5-triazin-2-amine.
| Compound Name | 4-[2-(4-fluorophenyl)ethynyl]-6-(4-methoxyphenyl)-N-[4-(trifluoromethoxy)phenyl]-1,3,5-triazin-2-amine |
|---|---|
| PubChem CID | 166452191 |
| Molecular Formula | C25H16F4N4O2 |
| Molecular Weight | 480.42 g/mol |
| Exact Mass | 480.12 |
| IUPAC Name | 4-[2-(4-fluorophenyl)ethynyl]-6-(4-methoxyphenyl)-N-[4-(trifluoromethoxy)phenyl]-1,3,5-triazin-2-amine |
| SMILES | COc1ccc(-c2nc(C#Cc3ccc(F)cc3)nc(Nc3ccc(OC(F)(F)F)cc3)n2)cc1 |
| InChI | InChI=1S/C25H16F4N4O2/c1-34-20-11-5-17(6-12-20)23-31-22(15-4-16-2-7-18(26)8-3-16)32-24(33-23)30-19-9-13-21(14-10-19)35-25(27,28)29/h2-3,5-14H,1H3,(H,30,31,32,33) |
| InChIKey | YMLWFILZVZGXDA-UHFFFAOYSA-N |
| XLogP | 5.73 |
| TPSA | 69.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 480.42 |
| LogP ≤ 5 | 5.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|