C22H22F4N5O+ — CID 143258631
[4-butanimidoyl-2-(4-fluorophenyl)-6-[4-(trifluoromethoxy)anilino]pyrimidin-5-yl]-methylazanium (PubChem CID 143258631) has the molecular formula C22H22F4N5O+ and a molecular weight of 448.44 g/mol. Its IUPAC name is [4-butanimidoyl-2-(4-fluorophenyl)-6-[4-(trifluoromethoxy)anilino]pyrimidin-5-yl]-methylazanium.
| Compound Name | [4-butanimidoyl-2-(4-fluorophenyl)-6-[4-(trifluoromethoxy)anilino]pyrimidin-5-yl]-methylazanium |
|---|---|
| PubChem CID | 143258631 |
| Molecular Formula | C22H22F4N5O+ |
| Molecular Weight | 448.44 g/mol |
| Exact Mass | 448.18 |
| IUPAC Name | [4-butanimidoyl-2-(4-fluorophenyl)-6-[4-(trifluoromethoxy)anilino]pyrimidin-5-yl]-methylazanium |
| SMILES | [H]/N=C(\CCC)c1nc(-c2ccc(F)cc2)nc(Nc2ccc(OC(F)(F)F)cc2)c1[NH2+]C |
| InChI | InChI=1S/C22H21F4N5O/c1-3-4-17(27)18-19(28-2)21(31-20(30-18)13-5-7-14(23)8-6-13)29-15-9-11-16(12-10-15)32-22(24,25)26/h5-12,27-28H,3-4H2,1-2H3,(H,29,30,31)/p+1/b27-17+ |
| InChIKey | NAVPQSTYXRZYOT-WPWMEQJKSA-O |
| XLogP | 4.92 |
| TPSA | 87.50 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.44 |
| LogP ≤ 5 | 4.92 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|