C23H23F3N4O3 — CID 42635274
N-(3-methoxypropyl)-4-[5-methyl-6-[4-(trifluoromethoxy)anilino]pyrimidin-4-yl]benzamide (PubChem CID 42635274) has the molecular formula C23H23F3N4O3 and a molecular weight of 460.46 g/mol. Its IUPAC name is N-(3-methoxypropyl)-4-[5-methyl-6-[4-(trifluoromethoxy)anilino]pyrimidin-4-yl]benzamide.
| Compound Name | N-(3-methoxypropyl)-4-[5-methyl-6-[4-(trifluoromethoxy)anilino]pyrimidin-4-yl]benzamide |
|---|---|
| PubChem CID | 42635274 |
| Molecular Formula | C23H23F3N4O3 |
| Molecular Weight | 460.46 g/mol |
| Exact Mass | 460.17 |
| IUPAC Name | N-(3-methoxypropyl)-4-[5-methyl-6-[4-(trifluoromethoxy)anilino]pyrimidin-4-yl]benzamide |
| SMILES | COCCCNC(=O)c1ccc(-c2ncnc(Nc3ccc(OC(F)(F)F)cc3)c2C)cc1 |
| InChI | InChI=1S/C23H23F3N4O3/c1-15-20(16-4-6-17(7-5-16)22(31)27-12-3-13-32-2)28-14-29-21(15)30-18-8-10-19(11-9-18)33-23(24,25)26/h4-11,14H,3,12-13H2,1-2H3,(H,27,31)(H,28,29,30) |
| InChIKey | JVBYUKONZCNFNZ-UHFFFAOYSA-N |
| XLogP | 4.86 |
| TPSA | 85.37 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 460.46 |
| LogP ≤ 5 | 4.86 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|